C33H68O5Si2 — CID 11192706
(Z,4R,6S,8S,11R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-6-methoxy-3,3,9-trimethyl-11-[tri(propan-2-yl)silyloxymethyl]tridec-9-en-2-one (PubChem CID 11192706) has the molecular formula C33H68O5Si2 and a molecular weight of 601.07 g/mol. Its IUPAC name is (Z,4R,6S,8S,11R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-6-methoxy-3,3,9-trimethyl-11-[tri(propan-2-yl)silyloxymethyl]tridec-9-en-2-one.
| Compound Name | (Z,4R,6S,8S,11R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-6-methoxy-3,3,9-trimethyl-11-[tri(propan-2-yl)silyloxymethyl]tridec-9-en-2-one |
|---|---|
| PubChem CID | 11192706 |
| Molecular Formula | C33H68O5Si2 |
| Molecular Weight | 601.07 g/mol |
| Exact Mass | 600.46 |
| IUPAC Name | (Z,4R,6S,8S,11R)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-6-methoxy-3,3,9-trimethyl-11-[tri(propan-2-yl)silyloxymethyl]tridec-9-en-2-one |
| SMILES | CC[C@H](/C=C(/C)[C@H](C[C@H](C[C@@H](O)C(C)(C)C(C)=O)OC)O[Si](C)(C)C(C)(C)C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H68O5Si2/c1-18-28(22-37-40(23(2)3,24(4)5)25(6)7)19-26(8)30(38-39(16,17)32(10,11)12)20-29(36-15)21-31(35)33(13,14)27(9)34/h19,23-25,28-31,35H,18,20-22H2,1-17H3/b26-19-/t28-,29-,30+,31-/m1/s1 |
| InChIKey | CUZAOOBHCUCFHY-JWIUFBLPSA-N |
| XLogP | 9.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.07 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|