About 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline
3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline (PubChem CID 1119276) has the molecular formula C21H23NO4
and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline |
| PubChem CID | 1119276 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline |
| SMILES | CCc1nc(-c2ccc(OC)c(OC)c2)cc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C21H23NO4/c1-6-16-15-12-21(26-5)20(25-4)11-14(15)9-17(22-16)13-7-8-18(23-2)19(10-13)24-3/h7-12H,6H2,1-5H3 |
| InChIKey | ZPFSDHHSBZSESO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline?
The IUPAC name of 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline (CID 1119276) is 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline is CCc1nc(-c2ccc(OC)c(OC)c2)cc2cc(OC)c(OC)cc12.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline?
The InChIKey is ZPFSDHHSBZSESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO4/c1-6-16-15-12-21(26-5)20(25-4)11-14(15)9-17(22-16)13-7-8-18(23-2)19(10-13)24-3/h7-12H,6H2,1-5H3.
What are the key properties of 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline?
3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline has a molecular weight of 353.42 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)-1-ethyl-6,7-dimethoxyisoquinoline is sourced from PubChem (CID 1119276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).