C30H24Cl2N4O4S — CID 11192770
2-phenylethyl 2-[2-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]propan-2-yl]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 11192770) has the molecular formula C30H24Cl2N4O4S and a molecular weight of 607.52 g/mol. Its IUPAC name is 2-phenylethyl 2-[2-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]propan-2-yl]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | 2-phenylethyl 2-[2-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]propan-2-yl]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 11192770 |
| Molecular Formula | C30H24Cl2N4O4S |
| Molecular Weight | 607.52 g/mol |
| Exact Mass | 606.09 |
| IUPAC Name | 2-phenylethyl 2-[2-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]propan-2-yl]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CC(C)(c1nc(-c2ccccc2)c(C(=O)OCCc2ccccc2)s1)c1c(Cl)cc(-n2ncc(=O)[nH]c2=O)cc1Cl |
| InChI | InChI=1S/C30H24Cl2N4O4S/c1-30(2,24-21(31)15-20(16-22(24)32)36-29(39)34-23(37)17-33-36)28-35-25(19-11-7-4-8-12-19)26(41-28)27(38)40-14-13-18-9-5-3-6-10-18/h3-12,15-17H,13-14H2,1-2H3,(H,34,37,39) |
| InChIKey | WQZDOPPAAWCMDI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |