C32H23N3O6S2 — CID 11192791
2-[1-(benzenesulfonyl)indol-3-yl]-N-[(E)-2-[1-(benzenesulfonyl)indol-3-yl]ethenyl]-2-oxoacetamide (PubChem CID 11192791) has the molecular formula C32H23N3O6S2 and a molecular weight of 609.69 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)indol-3-yl]-N-[(E)-2-[1-(benzenesulfonyl)indol-3-yl]ethenyl]-2-oxoacetamide.
| Compound Name | 2-[1-(benzenesulfonyl)indol-3-yl]-N-[(E)-2-[1-(benzenesulfonyl)indol-3-yl]ethenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 11192791 |
| Molecular Formula | C32H23N3O6S2 |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | 2-[1-(benzenesulfonyl)indol-3-yl]-N-[(E)-2-[1-(benzenesulfonyl)indol-3-yl]ethenyl]-2-oxoacetamide |
| SMILES | O=C(N/C=C/c1cn(S(=O)(=O)c2ccccc2)c2ccccc12)C(=O)c1cn(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C32H23N3O6S2/c36-31(28-22-35(30-18-10-8-16-27(28)30)43(40,41)25-13-5-2-6-14-25)32(37)33-20-19-23-21-34(29-17-9-7-15-26(23)29)42(38,39)24-11-3-1-4-12-24/h1-22H,(H,33,37)/b20-19+ |
| InChIKey | KITCVFPSORVLDV-FMQUCBEESA-N |
| XLogP | 5.04 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|