C18H37N5O2 — CID 111928490
2-methyl-N-[2-[[N'-methyl-N-(4-methyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]propanamide (PubChem CID 111928490) has the molecular formula C18H37N5O2 and a molecular weight of 355.53 g/mol. Its IUPAC name is 2-methyl-N-[2-[[N'-methyl-N-(4-methyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[[N'-methyl-N-(4-methyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 111928490 |
| Molecular Formula | C18H37N5O2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | 2-methyl-N-[2-[[N'-methyl-N-(4-methyl-2-morpholin-4-ylpentyl)carbamimidoyl]amino]ethyl]propanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)C)NCC(CC(C)C)N1CCOCC1 |
| InChI | InChI=1S/C18H37N5O2/c1-14(2)12-16(23-8-10-25-11-9-23)13-22-18(19-5)21-7-6-20-17(24)15(3)4/h14-16H,6-13H2,1-5H3,(H,20,24)(H2,19,21,22) |
| InChIKey | XDEZVKVZKRGEQG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|