C15H27IN4OS — CID 111928531
N-[2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111928531) has the molecular formula C15H27IN4OS and a molecular weight of 438.38 g/mol. Its IUPAC name is N-[2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111928531 |
| Molecular Formula | C15H27IN4OS |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-[2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCc1ccc(CN/C(=N/C)NCCNC(=O)C(C)C)s1.I |
| InChI | InChI=1S/C15H26N4OS.HI/c1-5-12-6-7-13(21-12)10-19-15(16-4)18-9-8-17-14(20)11(2)3;/h6-7,11H,5,8-10H2,1-4H3,(H,17,20)(H2,16,18,19);1H |
| InChIKey | JLRNIMJVAVBZFE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|