C32H20Br2N4 — CID 11192872
5,15-dibromo-10,20-diphenyl-21,22-dihydroporphyrin (PubChem CID 11192872) has the molecular formula C32H20Br2N4 and a molecular weight of 620.35 g/mol. Its IUPAC name is 5,15-dibromo-10,20-diphenyl-21,22-dihydroporphyrin.
| Compound Name | 5,15-dibromo-10,20-diphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11192872 |
| Molecular Formula | C32H20Br2N4 |
| Molecular Weight | 620.35 g/mol |
| Exact Mass | 618.01 |
| IUPAC Name | 5,15-dibromo-10,20-diphenyl-21,22-dihydroporphyrin |
| SMILES | Brc1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(Br)c3ccc([nH]3)c(-c3ccccc3)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C32H20Br2N4/c33-31-25-15-11-21(35-25)29(19-7-3-1-4-8-19)22-12-16-26(36-22)32(34)28-18-14-24(38-28)30(20-9-5-2-6-10-20)23-13-17-27(31)37-23/h1-18,35,37H/b29-21-,29-22-,30-23-,30-24-,31-25+,31-27+,32-26+,32-28+ |
| InChIKey | XBGDWJTUQWOPHM-IBRKNYKGSA-N |
| XLogP | 9.51 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.35 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |