C27H33ClF3N11O2 — CID 11192994
4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide (PubChem CID 11192994) has the molecular formula C27H33ClF3N11O2 and a molecular weight of 636.08 g/mol. Its IUPAC name is 4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide.
| Compound Name | 4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 11192994 |
| Molecular Formula | C27H33ClF3N11O2 |
| Molecular Weight | 636.08 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | 4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(C(=O)Nc4cc(C(F)(F)F)ccc4Cl)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C27H33ClF3N11O2/c28-20-4-1-13(27(29,30)31)5-21(20)37-23(44)19-3-2-18(8-22(19)43)36-24-38-25(41-9-14(32)6-15(33)10-41)40-26(39-24)42-11-16(34)7-17(35)12-42/h1-5,8,14-17,43H,6-7,9-12,32-35H2,(H,37,44)(H,36,38,39,40)/t14-,15+,16-,17+ |
| InChIKey | QTSUMVSPWQMMOF-WNKDZCFJSA-N |
| XLogP | 1.97 |
| TPSA | 210.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.08 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |