C35H46O9S — CID 11193041
[(1R,3R,5R,6S,8R,10S,12R,13S)-13-acetyloxy-3-ethylsulfanyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-yl]methyl acetate (PubChem CID 11193041) has the molecular formula C35H46O9S and a molecular weight of 642.81 g/mol. Its IUPAC name is [(1R,3R,5R,6S,8R,10S,12R,13S)-13-acetyloxy-3-ethylsulfanyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-yl]methyl acetate.
| Compound Name | [(1R,3R,5R,6S,8R,10S,12R,13S)-13-acetyloxy-3-ethylsulfanyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-yl]methyl acetate |
|---|---|
| PubChem CID | 11193041 |
| Molecular Formula | C35H46O9S |
| Molecular Weight | 642.81 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | [(1R,3R,5R,6S,8R,10S,12R,13S)-13-acetyloxy-3-ethylsulfanyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-yl]methyl acetate |
| SMILES | CCS[C@]12C[C@@H](OCc3ccccc3)[C@H](CCOCc3ccccc3)O[C@@H]1C[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)CC[C@H]1O2 |
| InChI | InChI=1S/C35H46O9S/c1-4-45-35-20-32(40-22-27-13-9-6-10-14-27)29(17-18-38-21-26-11-7-5-8-12-26)43-34(35)19-31-30(44-35)16-15-28(41-25(3)37)33(42-31)23-39-24(2)36/h5-14,28-34H,4,15-23H2,1-3H3/t28-,29-,30+,31-,32+,33+,34+,35+/m0/s1 |
| InChIKey | BGQRCSYGJJKRQJ-NGYFCSIDSA-N |
| XLogP | 5.62 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.81 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|