C41H43N8+ — CID 11193070
6-phenyl-5-[5-[3-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]triazol-4-yl]pentyl]phenanthridin-5-ium-3,8-diamine (PubChem CID 11193070) has the molecular formula C41H43N8+ and a molecular weight of 647.85 g/mol. Its IUPAC name is 6-phenyl-5-[5-[3-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]triazol-4-yl]pentyl]phenanthridin-5-ium-3,8-diamine.
| Compound Name | 6-phenyl-5-[5-[3-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]triazol-4-yl]pentyl]phenanthridin-5-ium-3,8-diamine |
|---|---|
| PubChem CID | 11193070 |
| Molecular Formula | C41H43N8+ |
| Molecular Weight | 647.85 g/mol |
| Exact Mass | 647.36 |
| IUPAC Name | 6-phenyl-5-[5-[3-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]triazol-4-yl]pentyl]phenanthridin-5-ium-3,8-diamine |
| SMILES | Nc1ccc2c(c1)c(-c1ccccc1)[n+](CCCCCc1cnnn1CCNc1c3c(nc4ccccc14)CCCC3)c1cc(N)ccc21 |
| InChI | InChI=1S/C41H42N8/c42-29-18-20-32-33-21-19-30(43)26-39(33)48(41(36(32)25-29)28-11-3-1-4-12-28)23-10-2-5-13-31-27-45-47-49(31)24-22-44-40-34-14-6-8-16-37(34)46-38-17-9-7-15-35(38)40/h1,3-4,6,8,11-12,14,16,18-21,25-27,43H,2,5,7,9-10,13,15,17,22-24,42H2,(H,44,46)/p+1 |
| InChIKey | ALUZXISFDWHPFA-UHFFFAOYSA-O |
| XLogP | 7.66 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.85 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|