C24H42N6O2 — CID 111930762
2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine (PubChem CID 111930762) has the molecular formula C24H42N6O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine.
| Compound Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111930762 |
| Molecular Formula | C24H42N6O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 2-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CC(C)OC(C)C2)nc1)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C24H42N6O2/c1-6-25-24(28-15-22(18(2)3)29-9-11-31-12-10-29)27-14-21-7-8-23(26-13-21)30-16-19(4)32-20(5)17-30/h7-8,13,18-20,22H,6,9-12,14-17H2,1-5H3,(H2,25,27,28) |
| InChIKey | RCMHEEXVSHLASK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|