C20H38IN7O2 — CID 111930803
2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111930803) has the molecular formula C20H38IN7O2 and a molecular weight of 535.48 g/mol. Its IUPAC name is 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111930803 |
| Molecular Formula | C20H38IN7O2 |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1nc2n(c1=O)CCCC2)NCC(C(C)C)N1CCOCC1.I |
| InChI | InChI=1S/C20H37N7O2.HI/c1-16(2)17(25-11-13-29-14-12-25)15-23-19(21-3)22-8-6-10-27-20(28)26-9-5-4-7-18(26)24-27;/h16-17H,4-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | AWKHCKVUFQNUNU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|