C23H40IN5O2 — CID 111930821
3-methyl-N-[3-[[[N'-methyl-N-(3-methyl-2-morpholin-4-ylbutyl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide (PubChem CID 111930821) has the molecular formula C23H40IN5O2 and a molecular weight of 545.51 g/mol. Its IUPAC name is 3-methyl-N-[3-[[[N'-methyl-N-(3-methyl-2-morpholin-4-ylbutyl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide.
| Compound Name | 3-methyl-N-[3-[[[N'-methyl-N-(3-methyl-2-morpholin-4-ylbutyl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111930821 |
| Molecular Formula | C23H40IN5O2 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 3-methyl-N-[3-[[[N'-methyl-N-(3-methyl-2-morpholin-4-ylbutyl)carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)CC(C)C)c1)NCC(C(C)C)N1CCOCC1.I |
| InChI | InChI=1S/C23H39N5O2.HI/c1-17(2)13-22(29)27-20-8-6-7-19(14-20)15-25-23(24-5)26-16-21(18(3)4)28-9-11-30-12-10-28;/h6-8,14,17-18,21H,9-13,15-16H2,1-5H3,(H,27,29)(H2,24,25,26);1H |
| InChIKey | GWYLUKQSCOIZAL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|