C32H31F3N4O6S — CID 11193116
4-methylbenzenesulfonic acid;4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole (PubChem CID 11193116) has the molecular formula C32H31F3N4O6S and a molecular weight of 656.68 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole.
| Compound Name | 4-methylbenzenesulfonic acid;4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 11193116 |
| Molecular Formula | C32H31F3N4O6S |
| Molecular Weight | 656.68 g/mol |
| Exact Mass | 656.19 |
| IUPAC Name | 4-methylbenzenesulfonic acid;4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.FC(F)(F)Oc1ccc(/C=C/c2nc(COc3ccc(CCCCn4ccnn4)cc3)co2)cc1 |
| InChI | InChI=1S/C25H23F3N4O3.C7H8O3S/c26-25(27,28)35-23-11-6-20(7-12-23)8-13-24-30-21(18-34-24)17-33-22-9-4-19(5-10-22)3-1-2-15-32-16-14-29-31-32;1-6-2-4-7(5-3-6)11(8,9)10/h4-14,16,18H,1-3,15,17H2;2-5H,1H3,(H,8,9,10)/b13-8+; |
| InChIKey | IXUQGCOHTQJNGM-FNXZNAJJSA-N |
| XLogP | 7.18 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.68 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|