C17H37N5O3S — CID 111931584
1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-(3-methyl-2-morpholin-4-ylbutyl)guanidine (PubChem CID 111931584) has the molecular formula C17H37N5O3S and a molecular weight of 391.58 g/mol. Its IUPAC name is 1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-(3-methyl-2-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111931584 |
| Molecular Formula | C17H37N5O3S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
| SMILES | CCN/C(=N\CC(C(C)C)N1CCOCC1)NCCCNS(=O)(=O)CC |
| InChI | InChI=1S/C17H37N5O3S/c1-5-18-17(19-8-7-9-21-26(23,24)6-2)20-14-16(15(3)4)22-10-12-25-13-11-22/h15-16,21H,5-14H2,1-4H3,(H2,18,19,20) |
| InChIKey | YJUDVOLXDMJNEW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|