C32H28Cl3NO9 — CID 11193229
[(2R,3R,4S,5S,6R)-3,5-dibenzoyloxy-4-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate (PubChem CID 11193229) has the molecular formula C32H28Cl3NO9 and a molecular weight of 676.93 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,5-dibenzoyloxy-4-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,5-dibenzoyloxy-4-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11193229 |
| Molecular Formula | C32H28Cl3NO9 |
| Molecular Weight | 676.93 g/mol |
| Exact Mass | 675.08 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,5-dibenzoyloxy-4-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OCC=C)[C@@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C32H28Cl3NO9/c1-2-18-40-25-24(43-28(38)21-14-8-4-9-15-21)23(19-41-27(37)20-12-6-3-7-13-20)42-30(45-31(36)32(33,34)35)26(25)44-29(39)22-16-10-5-11-17-22/h2-17,23-26,30,36H,1,18-19H2/b36-31+/t23-,24-,25+,26+,30-/m1/s1 |
| InChIKey | KJZNKLZPQXXGDH-GCOZBJNISA-N |
| XLogP | 5.95 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.93 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|