C16H22IN5O2S — CID 111932601
1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111932601) has the molecular formula C16H22IN5O2S and a molecular weight of 475.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111932601 |
| Molecular Formula | C16H22IN5O2S |
| Molecular Weight | 475.36 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1[N+](=O)[O-])NCCc1csc(C)n1.I |
| InChI | InChI=1S/C16H21N5O2S.HI/c1-3-17-16(18-9-8-14-11-24-12(2)20-14)19-10-13-6-4-5-7-15(13)21(22)23;/h4-7,11H,3,8-10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | FPSPBZCDENERPV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|