C21H26IN5OS — CID 111932927
2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111932927) has the molecular formula C21H26IN5OS and a molecular weight of 523.44 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111932927 |
| Molecular Formula | C21H26IN5OS |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCc1cccc(OCc2ccccn2)c1.I |
| InChI | InChI=1S/C21H25N5OS.HI/c1-16-26-19(15-28-16)9-11-24-21(22-2)25-13-17-6-5-8-20(12-17)27-14-18-7-3-4-10-23-18;/h3-8,10,12,15H,9,11,13-14H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | OUAOYMFGNSYRQV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|