C20H15ClN2O6 — CID 1119335
6-chloro-3-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one (PubChem CID 1119335) has the molecular formula C20H15ClN2O6 and a molecular weight of 414.80 g/mol. Its IUPAC name is 6-chloro-3-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one.
| Compound Name | 6-chloro-3-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 1119335 |
| Molecular Formula | C20H15ClN2O6 |
| Molecular Weight | 414.80 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 6-chloro-3-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one |
| SMILES | COc1cc(-c2nnc(-c3cc4cc(Cl)ccc4oc3=O)o2)cc(OC)c1OC |
| InChI | InChI=1S/C20H15ClN2O6/c1-25-15-8-11(9-16(26-2)17(15)27-3)18-22-23-19(29-18)13-7-10-6-12(21)4-5-14(10)28-20(13)24/h4-9H,1-3H3 |
| InChIKey | UGZSPHHLPOFIQT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|