C32H67NO6SiSn — CID 11193359
(E,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-3-(2-methoxyethoxymethoxy)-N-methyl-8-tributylstannyloct-7-enamide (PubChem CID 11193359) has the molecular formula C32H67NO6SiSn and a molecular weight of 708.69 g/mol. Its IUPAC name is (E,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-3-(2-methoxyethoxymethoxy)-N-methyl-8-tributylstannyloct-7-enamide.
| Compound Name | (E,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-3-(2-methoxyethoxymethoxy)-N-methyl-8-tributylstannyloct-7-enamide |
|---|---|
| PubChem CID | 11193359 |
| Molecular Formula | C32H67NO6SiSn |
| Molecular Weight | 708.69 g/mol |
| Exact Mass | 709.38 |
| IUPAC Name | (E,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-3-(2-methoxyethoxymethoxy)-N-methyl-8-tributylstannyloct-7-enamide |
| SMILES | CCCC[Sn](/C=C/C[C@@H](C[C@@H](CC(=O)N(C)OC)OCOCCOC)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C20H40NO6Si.3C4H9.Sn/c1-10-11-17(27-28(8,9)20(2,3)4)14-18(15-19(22)21(5)24-7)26-16-25-13-12-23-6;3*1-3-4-2;/h1,10,17-18H,11-16H2,2-9H3;3*1,3-4H2,2H3;/t17-,18-;;;;/m0..../s1 |
| InChIKey | JQJLZCHJJKOPEK-WSNGVDDISA-N |
| XLogP | 8.52 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.69 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|