C19H26N4S — CID 111933627
2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)guanidine (PubChem CID 111933627) has the molecular formula C19H26N4S and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111933627 |
| Molecular Formula | C19H26N4S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)guanidine |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H26N4S/c1-14-23-17(13-24-14)10-11-21-19(20-2)22-12-16-8-5-7-15-6-3-4-9-18(15)16/h3-4,6,9,13,16H,5,7-8,10-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | UMJGXBGWRKRDMQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|