About 2-hydroxybutanebis(thioic S-acid)
2-hydroxybutanebis(thioic S-acid) (PubChem CID 11193418) has the molecular formula C4H6O3S2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-hydroxybutanebis(thioic S-acid).
Molecular Properties
| Compound Name | 2-hydroxybutanebis(thioic S-acid) |
| PubChem CID | 11193418 |
| Molecular Formula | C4H6O3S2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 165.98 |
| IUPAC Name | 2-hydroxybutanebis(thioic S-acid) |
| SMILES | O=C(S)CC(O)C(=O)S |
| InChI | InChI=1S/C4H6O3S2/c5-2(4(7)9)1-3(6)8/h2,5H,1H2,(H,6,8)(H,7,9) |
| InChIKey | IPWRMTYPSSCAGQ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutanebis(thioic S-acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanebis(thioic S-acid)?
The IUPAC name of 2-hydroxybutanebis(thioic S-acid) (CID 11193418) is 2-hydroxybutanebis(thioic S-acid).
What is the SMILES notation for 2-hydroxybutanebis(thioic S-acid)?
The canonical SMILES for 2-hydroxybutanebis(thioic S-acid) is O=C(S)CC(O)C(=O)S.
What is the InChIKey of 2-hydroxybutanebis(thioic S-acid)?
The InChIKey is IPWRMTYPSSCAGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3S2/c5-2(4(7)9)1-3(6)8/h2,5H,1H2,(H,6,8)(H,7,9).
What are the key properties of 2-hydroxybutanebis(thioic S-acid)?
2-hydroxybutanebis(thioic S-acid) has a molecular weight of 166.22 g/mol, XLogP of -0.35, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanebis(thioic S-acid) is sourced from PubChem (CID 11193418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).