C15H27N5OS — CID 111934549
1-ethyl-2-[(4-methylmorpholin-2-yl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111934549) has the molecular formula C15H27N5OS and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methylmorpholin-2-yl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(4-methylmorpholin-2-yl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111934549 |
| Molecular Formula | C15H27N5OS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-ethyl-2-[(4-methylmorpholin-2-yl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC1CN(C)CCO1)NCCc1csc(C)n1 |
| InChI | InChI=1S/C15H27N5OS/c1-4-16-15(17-6-5-13-11-22-12(2)19-13)18-9-14-10-20(3)7-8-21-14/h11,14H,4-10H2,1-3H3,(H2,16,17,18) |
| InChIKey | ILBIIGFNWOFOBD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|