C21H37N5O2 — CID 111935195
1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine (PubChem CID 111935195) has the molecular formula C21H37N5O2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine.
| Compound Name | 1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
|---|---|
| PubChem CID | 111935195 |
| Molecular Formula | C21H37N5O2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | 1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
| SMILES | C/N=C(/NCc1ncc(C)c(OC)c1C)NCC(CC(C)C)N1CCOCC1 |
| InChI | InChI=1S/C21H37N5O2/c1-15(2)11-18(26-7-9-28-10-8-26)13-24-21(22-5)25-14-19-17(4)20(27-6)16(3)12-23-19/h12,15,18H,7-11,13-14H2,1-6H3,(H2,22,24,25) |
| InChIKey | BQFJBUSFCJOGBA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|