C20H35N5O2 — CID 111935295
1-ethyl-2-[(2-methoxy-3-pyridinyl)methyl]-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine (PubChem CID 111935295) has the molecular formula C20H35N5O2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methoxy-3-pyridinyl)methyl]-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine.
| Compound Name | 1-ethyl-2-[(2-methoxy-3-pyridinyl)methyl]-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
|---|---|
| PubChem CID | 111935295 |
| Molecular Formula | C20H35N5O2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 1-ethyl-2-[(2-methoxy-3-pyridinyl)methyl]-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1OC)NCC(CC(C)C)N1CCOCC1 |
| InChI | InChI=1S/C20H35N5O2/c1-5-21-20(23-14-17-7-6-8-22-19(17)26-4)24-15-18(13-16(2)3)25-9-11-27-12-10-25/h6-8,16,18H,5,9-15H2,1-4H3,(H2,21,23,24) |
| InChIKey | RGXNVFYQEBMXOW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|