C25H42N4O2 — CID 111935591
1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-[(2-phenyloxan-3-yl)methyl]guanidine (PubChem CID 111935591) has the molecular formula C25H42N4O2 and a molecular weight of 430.64 g/mol. Its IUPAC name is 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-[(2-phenyloxan-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-[(2-phenyloxan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111935591 |
| Molecular Formula | C25H42N4O2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | 1-ethyl-2-(4-methyl-2-morpholin-4-ylpentyl)-3-[(2-phenyloxan-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(CC(C)C)N1CCOCC1)NCC1CCCOC1c1ccccc1 |
| InChI | InChI=1S/C25H42N4O2/c1-4-26-25(28-19-23(17-20(2)3)29-12-15-30-16-13-29)27-18-22-11-8-14-31-24(22)21-9-6-5-7-10-21/h5-7,9-10,20,22-24H,4,8,11-19H2,1-3H3,(H2,26,27,28) |
| InChIKey | OQZZHRREEUMCIT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|