C37H49N6O9PSi — CID 11193596
[(2R,3R,4R,5R)-5-(6-acetamido-8-oxo-7H-purin-9-yl)-4-benzoyloxy-2-[[[di(propan-2-yl)amino]-(2-trimethylsilylethoxy)phosphanyl]oxymethyl]oxolan-3-yl] benzoate (PubChem CID 11193596) has the molecular formula C37H49N6O9PSi and a molecular weight of 780.89 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-acetamido-8-oxo-7H-purin-9-yl)-4-benzoyloxy-2-[[[di(propan-2-yl)amino]-(2-trimethylsilylethoxy)phosphanyl]oxymethyl]oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-(6-acetamido-8-oxo-7H-purin-9-yl)-4-benzoyloxy-2-[[[di(propan-2-yl)amino]-(2-trimethylsilylethoxy)phosphanyl]oxymethyl]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11193596 |
| Molecular Formula | C37H49N6O9PSi |
| Molecular Weight | 780.89 g/mol |
| Exact Mass | 780.31 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-acetamido-8-oxo-7H-purin-9-yl)-4-benzoyloxy-2-[[[di(propan-2-yl)amino]-(2-trimethylsilylethoxy)phosphanyl]oxymethyl]oxolan-3-yl] benzoate |
| SMILES | CC(=O)Nc1ncnc2c1[nH]c(=O)n2[C@@H]1O[C@H](COP(OCC[Si](C)(C)C)N(C(C)C)C(C)C)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H49N6O9PSi/c1-23(2)43(24(3)4)53(48-19-20-54(6,7)8)49-21-28-30(51-35(45)26-15-11-9-12-16-26)31(52-36(46)27-17-13-10-14-18-27)34(50-28)42-33-29(41-37(42)47)32(38-22-39-33)40-25(5)44/h9-18,22-24,28,30-31,34H,19-21H2,1-8H3,(H,41,47)(H,38,39,40,44)/t28-,30-,31-,34-,53?/m1/s1 |
| InChIKey | OXUZESUSZWSKQH-SYBXZEODSA-N |
| XLogP | 6.14 |
| TPSA | 176.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.89 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|