C23H38IN7O — CID 111936234
1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111936234) has the molecular formula C23H38IN7O and a molecular weight of 555.51 g/mol. Its IUPAC name is 1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111936234 |
| Molecular Formula | C23H38IN7O |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCC(CC)C(CN/C(=N\C)NCc1ccc(-n2ccnc2C)nc1)N1CCOCC1.I |
| InChI | InChI=1S/C23H37N7O.HI/c1-5-20(6-2)21(29-11-13-31-14-12-29)17-28-23(24-4)27-16-19-7-8-22(26-15-19)30-10-9-25-18(30)3;/h7-10,15,20-21H,5-6,11-14,16-17H2,1-4H3,(H2,24,27,28);1H |
| InChIKey | RTHDYXRTHIPONC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|