C30H17BF20Si — CID 11193637
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;triethylsilanylium (PubChem CID 11193637) has the molecular formula C30H17BF20Si and a molecular weight of 796.32 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;triethylsilanylium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;triethylsilanylium |
|---|---|
| PubChem CID | 11193637 |
| Molecular Formula | C30H17BF20Si |
| Molecular Weight | 796.32 g/mol |
| Exact Mass | 796.09 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;triethylsilanylium |
| SMILES | CC[SiH2+](CC)CC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C6H17Si/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-4-7(5-2)6-3/h;4-7H2,1-3H3/q-1;+1 |
| InChIKey | MTLOCUYDJSXKDU-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.32 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|