C23H44IN7O2 — CID 111936714
1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111936714) has the molecular formula C23H44IN7O2 and a molecular weight of 577.56 g/mol. Its IUPAC name is 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111936714 |
| Molecular Formula | C23H44IN7O2 |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 1-ethyl-2-(3-ethyl-2-morpholin-4-ylpentyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C(CC)CC)N1CCOCC1)NCCCn1nc2n(c1=O)CCCC2.I |
| InChI | InChI=1S/C23H43N7O2.HI/c1-4-19(5-2)20(28-14-16-32-17-15-28)18-26-22(24-6-3)25-11-9-13-30-23(31)29-12-8-7-10-21(29)27-30;/h19-20H,4-18H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | NPRRUBMEGHBNQD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|