C20H38IN5O — CID 111937470
1-[2-(azepan-1-yl)-3-methylbutyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111937470) has the molecular formula C20H38IN5O and a molecular weight of 491.46 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-3-methylbutyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111937470 |
| Molecular Formula | C20H38IN5O |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCC(C(C)C)N1CCCCCC1.I |
| InChI | InChI=1S/C20H37N5O.HI/c1-6-21-20(23-14-19-24-16(4)17(5)26-19)22-13-18(15(2)3)25-11-9-7-8-10-12-25;/h15,18H,6-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | PWVQYIKZBMGADJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|