About dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane)
dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane) (PubChem CID 11193829) has the molecular formula C51H40Cl2P2Ru
and a molecular weight of 886.81 g/mol. Its IUPAC name is dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane).
Molecular Properties
| Compound Name | dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane) |
| PubChem CID | 11193829 |
| Molecular Formula | C51H40Cl2P2Ru |
| Molecular Weight | 886.81 g/mol |
| Exact Mass | 886.10 |
| IUPAC Name | dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane) |
| SMILES | Cl[Ru](Cl)=C1C=C(c2ccccc2)c2ccccc21.c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15P.C15H10.2ClH.Ru/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;;;/h2*1-15H;1-9,11H;2*1H;/q;;;;;+2/p-2 |
| InChIKey | OSXYZGLDXSALQC-UHFFFAOYSA-L |
| XLogP | 11.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 886.81 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane)?
The IUPAC name of dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane) (CID 11193829) is dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane).
What is the SMILES notation for dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane)?
The canonical SMILES for dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane) is Cl[Ru](Cl)=C1C=C(c2ccccc2)c2ccccc21.c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane)?
The InChIKey is OSXYZGLDXSALQC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H15P.C15H10.2ClH.Ru/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;;;/h2*1-15H;1-9,11H;2*1H;/q;;;;;+2/p-2.
What are the key properties of dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane)?
dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane) has a molecular weight of 886.81 g/mol, XLogP of 11.47, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-(3-phenylinden-1-ylidene)ruthenium;bis(triphenylphosphane) is sourced from PubChem (CID 11193829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).