C24H34N4 — CID 111938503
1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111938503) has the molecular formula C24H34N4 and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111938503 |
| Molecular Formula | C24H34N4 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(C)cc1C)NCC1CCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C24H34N4/c1-19-9-10-23(20(2)15-19)17-27-24(25-3)26-16-22-12-14-28(18-22)13-11-21-7-5-4-6-8-21/h4-10,15,22H,11-14,16-18H2,1-3H3,(H2,25,26,27) |
| InChIKey | ZCEDZRDALJPSPK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|