C17H23ClIN3O2S — CID 111940446
1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111940446) has the molecular formula C17H23ClIN3O2S and a molecular weight of 495.81 g/mol. Its IUPAC name is 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111940446 |
| Molecular Formula | C17H23ClIN3O2S |
| Molecular Weight | 495.81 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCOc1c(Cl)cc(CN/C(=N/C)NCc2ccsc2)cc1OC.I |
| InChI | InChI=1S/C17H22ClN3O2S.HI/c1-4-23-16-14(18)7-13(8-15(16)22-3)10-21-17(19-2)20-9-12-5-6-24-11-12;/h5-8,11H,4,9-10H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | WPHZIPVDGBDZOI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|