C15H23N5S — CID 111940859
1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]-2-(thiophen-3-ylmethyl)guanidine (PubChem CID 111940859) has the molecular formula C15H23N5S and a molecular weight of 305.45 g/mol. Its IUPAC name is 1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]-2-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]-2-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111940859 |
| Molecular Formula | C15H23N5S |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]-2-(thiophen-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccsc1)NCCCc1cnn(C)c1 |
| InChI | InChI=1S/C15H23N5S/c1-3-16-15(18-9-14-6-8-21-12-14)17-7-4-5-13-10-19-20(2)11-13/h6,8,10-12H,3-5,7,9H2,1-2H3,(H2,16,17,18) |
| InChIKey | IFWCUGBBNOWBLI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|