C21H25IN4O2S — CID 111940974
2-methyl-1-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111940974) has the molecular formula C21H25IN4O2S and a molecular weight of 524.43 g/mol. Its IUPAC name is 2-methyl-1-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111940974 |
| Molecular Formula | C21H25IN4O2S |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 2-methyl-1-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OCCOc2ccccc2)nc1)NCc1ccsc1.I |
| InChI | InChI=1S/C21H24N4O2S.HI/c1-22-21(25-15-18-9-12-28-16-18)24-14-17-7-8-20(23-13-17)27-11-10-26-19-5-3-2-4-6-19;/h2-9,12-13,16H,10-11,14-15H2,1H3,(H2,22,24,25);1H |
| InChIKey | QOOOOUXUYDQXMV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|