C19H39N5O — CID 111942127
N,N-diethyl-3-[[N-ethyl-N'-[(1-propylpiperidin-4-yl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111942127) has the molecular formula C19H39N5O and a molecular weight of 353.56 g/mol. Its IUPAC name is N,N-diethyl-3-[[N-ethyl-N'-[(1-propylpiperidin-4-yl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N,N-diethyl-3-[[N-ethyl-N'-[(1-propylpiperidin-4-yl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111942127 |
| Molecular Formula | C19H39N5O |
| Molecular Weight | 353.56 g/mol |
| Exact Mass | 353.32 |
| IUPAC Name | N,N-diethyl-3-[[N-ethyl-N'-[(1-propylpiperidin-4-yl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCCN1CCC(C/N=C(\NCC)NCCC(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C19H39N5O/c1-5-13-23-14-10-17(11-15-23)16-22-19(20-6-2)21-12-9-18(25)24(7-3)8-4/h17H,5-16H2,1-4H3,(H2,20,21,22) |
| InChIKey | WTCFIGCEXBKWPW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|