C22H37ClIN5O2 — CID 111942298
3-[[N'-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111942298) has the molecular formula C22H37ClIN5O2 and a molecular weight of 565.93 g/mol. Its IUPAC name is 3-[[N'-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111942298 |
| Molecular Formula | C22H37ClIN5O2 |
| Molecular Weight | 565.93 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 3-[[N'-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1Cl)N1CCOCC1)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C22H36ClN5O2.HI/c1-4-24-22(25-12-11-21(29)27(5-2)6-3)26-17-20(28-13-15-30-16-14-28)18-9-7-8-10-19(18)23;/h7-10,20H,4-6,11-17H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | YXBUFPFBJFUASW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.93 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|