About (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine
(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine (PubChem CID 11194331) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine.
Molecular Properties
| Compound Name | (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine |
| PubChem CID | 11194331 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine |
| SMILES | C/C(N)=C/C1=NCCC1 |
| InChI | InChI=1S/C7H12N2/c1-6(8)5-7-3-2-4-9-7/h5H,2-4,8H2,1H3/b6-5- |
| InChIKey | MIEKTQNVLICORZ-WAYWQWQTSA-N |
| XLogP | 1.08 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine?
The IUPAC name of (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine (CID 11194331) is (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine.
What is the SMILES notation for (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine?
The canonical SMILES for (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine is C/C(N)=C/C1=NCCC1.
What is the InChIKey of (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine?
The InChIKey is MIEKTQNVLICORZ-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H12N2/c1-6(8)5-7-3-2-4-9-7/h5H,2-4,8H2,1H3/b6-5-.
What are the key properties of (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine?
(Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine has a molecular weight of 124.19 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-amine is sourced from PubChem (CID 11194331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).