About 1-oxidopyrrolidine-2,5-dione
1-oxidopyrrolidine-2,5-dione (PubChem CID 11194364) has the molecular formula C4H4NO3-
and a molecular weight of 114.08 g/mol. Its IUPAC name is 1-oxidopyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-oxidopyrrolidine-2,5-dione |
| PubChem CID | 11194364 |
| Molecular Formula | C4H4NO3- |
| Molecular Weight | 114.08 g/mol |
| Exact Mass | 114.02 |
| IUPAC Name | 1-oxidopyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1[O-] |
| InChI | InChI=1S/C4H4NO3/c6-3-1-2-4(7)5(3)8/h1-2H2/q-1 |
| InChIKey | KVSFKOYIPAZYLG-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.08 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-oxidopyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxidopyrrolidine-2,5-dione?
The IUPAC name of 1-oxidopyrrolidine-2,5-dione (CID 11194364) is 1-oxidopyrrolidine-2,5-dione.
What is the SMILES notation for 1-oxidopyrrolidine-2,5-dione?
The canonical SMILES for 1-oxidopyrrolidine-2,5-dione is O=C1CCC(=O)N1[O-].
What is the InChIKey of 1-oxidopyrrolidine-2,5-dione?
The InChIKey is KVSFKOYIPAZYLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4NO3/c6-3-1-2-4(7)5(3)8/h1-2H2/q-1.
What are the key properties of 1-oxidopyrrolidine-2,5-dione?
1-oxidopyrrolidine-2,5-dione has a molecular weight of 114.08 g/mol, XLogP of -0.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxidopyrrolidine-2,5-dione is sourced from PubChem (CID 11194364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).