C6H7NO3 — CID 11194386
[(2S)-5-oxo-1,2-dihydropyrrol-2-yl] acetate (PubChem CID 11194386) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is [(2S)-5-oxo-1,2-dihydropyrrol-2-yl] acetate.
| Compound Name | [(2S)-5-oxo-1,2-dihydropyrrol-2-yl] acetate |
|---|---|
| PubChem CID | 11194386 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | [(2S)-5-oxo-1,2-dihydropyrrol-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=CC(=O)N1 |
| InChI | InChI=1S/C6H7NO3/c1-4(8)10-6-3-2-5(9)7-6/h2-3,6H,1H3,(H,7,9)/t6-/m0/s1 |
| InChIKey | TWMZVXALUSOBCB-LURJTMIESA-N |
| XLogP | -0.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |