C20H35N3O — CID 111945201
1-(4-ethoxybutyl)-3-ethyl-2-(5-phenylpentyl)guanidine (PubChem CID 111945201) has the molecular formula C20H35N3O and a molecular weight of 333.52 g/mol. Its IUPAC name is 1-(4-ethoxybutyl)-3-ethyl-2-(5-phenylpentyl)guanidine.
| Compound Name | 1-(4-ethoxybutyl)-3-ethyl-2-(5-phenylpentyl)guanidine |
|---|---|
| PubChem CID | 111945201 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 1-(4-ethoxybutyl)-3-ethyl-2-(5-phenylpentyl)guanidine |
| SMILES | CCN/C(=N\CCCCCc1ccccc1)NCCCCOCC |
| InChI | InChI=1S/C20H35N3O/c1-3-21-20(23-17-11-12-18-24-4-2)22-16-10-6-9-15-19-13-7-5-8-14-19/h5,7-8,13-14H,3-4,6,9-12,15-18H2,1-2H3,(H2,21,22,23) |
| InChIKey | KJRRJCQUMWLABY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|