C10H14O2 — CID 11194536
2,6,6-trimethylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 11194536) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,6,6-trimethylcyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 2,6,6-trimethylcyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 11194536 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2,6,6-trimethylcyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(C)(C)CC=C1 |
| InChI | InChI=1S/C10H14O2/c1-7-5-4-6-10(2,3)8(7)9(11)12/h4-5H,6H2,1-3H3,(H,11,12) |
| InChIKey | KEKWJMVAZROFBL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |