C8H15NO3 — CID 11194609
(6S,7S,8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-6,7,8-triol (PubChem CID 11194609) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (6S,7S,8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-6,7,8-triol.
| Compound Name | (6S,7S,8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-6,7,8-triol |
|---|---|
| PubChem CID | 11194609 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (6S,7S,8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-6,7,8-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](O)CN2CCC[C@H]12 |
| InChI | InChI=1S/C8H15NO3/c10-6-4-9-3-1-2-5(9)7(11)8(6)12/h5-8,10-12H,1-4H2/t5-,6+,7+,8+/m1/s1 |
| InChIKey | NCQXPGNMJJWGLP-KVPKETBZSA-N |
| XLogP | -1.45 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |