About (1S,2S)-cyclohex-3-ene-1,2-diamine
(1S,2S)-cyclohex-3-ene-1,2-diamine (PubChem CID 11194740) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is (1S,2S)-cyclohex-3-ene-1,2-diamine.
Molecular Properties
| Compound Name | (1S,2S)-cyclohex-3-ene-1,2-diamine |
| PubChem CID | 11194740 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (1S,2S)-cyclohex-3-ene-1,2-diamine |
| SMILES | N[C@H]1C=CCC[C@@H]1N |
| InChI | InChI=1S/C6H12N2/c7-5-3-1-2-4-6(5)8/h1,3,5-6H,2,4,7-8H2/t5-,6-/m0/s1 |
| InChIKey | JKOVPYIQCZTDND-WDSKDSINSA-N |
| XLogP | -0.01 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,2S)-cyclohex-3-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-cyclohex-3-ene-1,2-diamine?
The IUPAC name of (1S,2S)-cyclohex-3-ene-1,2-diamine (CID 11194740) is (1S,2S)-cyclohex-3-ene-1,2-diamine.
What is the SMILES notation for (1S,2S)-cyclohex-3-ene-1,2-diamine?
The canonical SMILES for (1S,2S)-cyclohex-3-ene-1,2-diamine is N[C@H]1C=CCC[C@@H]1N.
What is the InChIKey of (1S,2S)-cyclohex-3-ene-1,2-diamine?
The InChIKey is JKOVPYIQCZTDND-WDSKDSINSA-N. The full InChI is InChI=1S/C6H12N2/c7-5-3-1-2-4-6(5)8/h1,3,5-6H,2,4,7-8H2/t5-,6-/m0/s1.
What are the key properties of (1S,2S)-cyclohex-3-ene-1,2-diamine?
(1S,2S)-cyclohex-3-ene-1,2-diamine has a molecular weight of 112.18 g/mol, XLogP of -0.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-cyclohex-3-ene-1,2-diamine is sourced from PubChem (CID 11194740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).