C12H12O2 — CID 11194792
(1'R,2S,2'R,6'S,7'S)-spiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one (PubChem CID 11194792) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (1'R,2S,2'R,6'S,7'S)-spiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one.
| Compound Name | (1'R,2S,2'R,6'S,7'S)-spiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one |
|---|---|
| PubChem CID | 11194792 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (1'R,2S,2'R,6'S,7'S)-spiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one |
| SMILES | O=C1[C@H]2C=C[C@H]([C@@H]3CC=C[C@@H]32)[C@]12CO2 |
| InChI | InChI=1S/C12H12O2/c13-11-9-4-5-10(12(11)6-14-12)8-3-1-2-7(8)9/h1-2,4-5,7-10H,3,6H2/t7-,8+,9-,10+,12+/m0/s1 |
| InChIKey | CHSPVBNULOYJDK-KUNJHIDRSA-N |
| XLogP | 1.33 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|