C11H10O3 — CID 11194815
2,2-dimethylchromene-5,8-dione (PubChem CID 11194815) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2,2-dimethylchromene-5,8-dione.
| Compound Name | 2,2-dimethylchromene-5,8-dione |
|---|---|
| PubChem CID | 11194815 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2,2-dimethylchromene-5,8-dione |
| SMILES | CC1(C)C=CC2=C(O1)C(=O)C=CC2=O |
| InChI | InChI=1S/C11H10O3/c1-11(2)6-5-7-8(12)3-4-9(13)10(7)14-11/h3-6H,1-2H3 |
| InChIKey | JSQKKBGEOFZYPG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|