C13H18O — CID 11194828
(2E,4E,6E,8E)-10,10-dimethylundeca-2,4,6,8-tetraenal (PubChem CID 11194828) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (2E,4E,6E,8E)-10,10-dimethylundeca-2,4,6,8-tetraenal.
| Compound Name | (2E,4E,6E,8E)-10,10-dimethylundeca-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 11194828 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (2E,4E,6E,8E)-10,10-dimethylundeca-2,4,6,8-tetraenal |
| SMILES | CC(C)(C)/C=C/C=C/C=C/C=C/C=O |
| InChI | InChI=1S/C13H18O/c1-13(2,3)11-9-7-5-4-6-8-10-12-14/h4-12H,1-3H3/b6-4+,7-5+,10-8+,11-9+ |
| InChIKey | QVBHZDZRZMNCMR-LOVBCJNSSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|