About ethyl 4-carbamoylbenzoate
ethyl 4-carbamoylbenzoate (PubChem CID 11194872) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is ethyl 4-carbamoylbenzoate.
Molecular Properties
| Compound Name | ethyl 4-carbamoylbenzoate |
| PubChem CID | 11194872 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | ethyl 4-carbamoylbenzoate |
| SMILES | CCOC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C10H11NO3/c1-2-14-10(13)8-5-3-7(4-6-8)9(11)12/h3-6H,2H2,1H3,(H2,11,12) |
| InChIKey | VLKGYFSQZMKYOT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-carbamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-carbamoylbenzoate?
The IUPAC name of ethyl 4-carbamoylbenzoate (CID 11194872) is ethyl 4-carbamoylbenzoate.
What is the SMILES notation for ethyl 4-carbamoylbenzoate?
The canonical SMILES for ethyl 4-carbamoylbenzoate is CCOC(=O)c1ccc(C(N)=O)cc1.
What is the InChIKey of ethyl 4-carbamoylbenzoate?
The InChIKey is VLKGYFSQZMKYOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-2-14-10(13)8-5-3-7(4-6-8)9(11)12/h3-6H,2H2,1H3,(H2,11,12).
What are the key properties of ethyl 4-carbamoylbenzoate?
ethyl 4-carbamoylbenzoate has a molecular weight of 193.20 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-carbamoylbenzoate is sourced from PubChem (CID 11194872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).