C22H29N3O3 — CID 111948897
1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl]-3-ethylguanidine (PubChem CID 111948897) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl]-3-ethylguanidine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111948897 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCC)c(OC)c1)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C22H29N3O3/c1-4-23-22(25-15-18-13-17-8-6-7-9-19(17)28-18)24-14-16-10-11-20(27-5-2)21(12-16)26-3/h6-12,18H,4-5,13-15H2,1-3H3,(H2,23,24,25) |
| InChIKey | LMLVIDIOCLFUHQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|